C14H17N3O6S — CID 66870200
[(2R,5S)-2-(benzylcarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 66870200) has the molecular formula C14H17N3O6S and a molecular weight of 355.37 g/mol. Its IUPAC name is [(2R,5S)-2-(benzylcarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2R,5S)-2-(benzylcarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 66870200 |
| Molecular Formula | C14H17N3O6S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | [(2R,5S)-2-(benzylcarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(NCc1ccccc1)[C@H]1CC[C@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C14H17N3O6S/c18-13(15-8-10-4-2-1-3-5-10)12-7-6-11-9-16(12)14(19)17(11)23-24(20,21)22/h1-5,11-12H,6-9H2,(H,15,18)(H,20,21,22)/t11-,12+/m0/s1 |
| InChIKey | ZDZLZLBMGLFZKY-NWDGAFQWSA-N |
| XLogP | 0.31 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|