C25H38N2O7 — CID 66870212
benzyl 2-[[(2S)-1,1-diethoxy-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 66870212) has the molecular formula C25H38N2O7 and a molecular weight of 478.59 g/mol. Its IUPAC name is benzyl 2-[[(2S)-1,1-diethoxy-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-[[(2S)-1,1-diethoxy-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66870212 |
| Molecular Formula | C25H38N2O7 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | benzyl 2-[[(2S)-1,1-diethoxy-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CCOC(OCC)[C@H](CC(=O)OC(C)(C)C)NC(=O)C1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H38N2O7/c1-6-31-23(32-7-2)19(16-21(28)34-25(3,4)5)26-22(29)20-14-11-15-27(20)24(30)33-17-18-12-9-8-10-13-18/h8-10,12-13,19-20,23H,6-7,11,14-17H2,1-5H3,(H,26,29)/t19-,20?/m0/s1 |
| InChIKey | PYJWAOAVEAJLOU-XJDOXCRVSA-N |
| XLogP | 3.40 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|