C19H22N2O6 — CID 66870233
benzyl (2R,5S)-7-oxo-6-(2-oxo-2-prop-2-enoxyethoxy)-1,6-diazabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 66870233) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is benzyl (2R,5S)-7-oxo-6-(2-oxo-2-prop-2-enoxyethoxy)-1,6-diazabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | benzyl (2R,5S)-7-oxo-6-(2-oxo-2-prop-2-enoxyethoxy)-1,6-diazabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 66870233 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | benzyl (2R,5S)-7-oxo-6-(2-oxo-2-prop-2-enoxyethoxy)-1,6-diazabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | C=CCOC(=O)CON1C(=O)N2C[C@@H]1CC[C@@H]2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H22N2O6/c1-2-10-25-17(22)13-27-21-15-8-9-16(20(11-15)19(21)24)18(23)26-12-14-6-4-3-5-7-14/h2-7,15-16H,1,8-13H2/t15-,16+/m0/s1 |
| InChIKey | ZBNDWHXAGLKSPK-JKSUJKDBSA-N |
| XLogP | 1.66 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|