C31H42N6O9S2 — CID 66870525
[(7E)-4-(cyclopropylsulfonylcarbamoyl)-2,15-dioxo-3,14,16-triazatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 5-(dimethylsulfamoyl)-2,3-dihydroindole-1-carboxylate (PubChem CID 66870525) has the molecular formula C31H42N6O9S2 and a molecular weight of 706.84 g/mol. Its IUPAC name is [(7E)-4-(cyclopropylsulfonylcarbamoyl)-2,15-dioxo-3,14,16-triazatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 5-(dimethylsulfamoyl)-2,3-dihydroindole-1-carboxylate.
| Compound Name | [(7E)-4-(cyclopropylsulfonylcarbamoyl)-2,15-dioxo-3,14,16-triazatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 5-(dimethylsulfamoyl)-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 66870525 |
| Molecular Formula | C31H42N6O9S2 |
| Molecular Weight | 706.84 g/mol |
| Exact Mass | 706.25 |
| IUPAC Name | [(7E)-4-(cyclopropylsulfonylcarbamoyl)-2,15-dioxo-3,14,16-triazatricyclo[14.3.0.04,6]nonadec-7-en-18-yl] 5-(dimethylsulfamoyl)-2,3-dihydroindole-1-carboxylate |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)CCN2C(=O)OC1CC2C(=O)NC3(C(=O)NS(=O)(=O)C4CC4)CC3/C=C/CCCCCNC(=O)N2C1 |
| InChI | InChI=1S/C31H42N6O9S2/c1-35(2)48(44,45)24-11-12-25-20(16-24)13-15-36(25)30(41)46-22-17-26-27(38)33-31(28(39)34-47(42,43)23-9-10-23)18-21(31)8-6-4-3-5-7-14-32-29(40)37(26)19-22/h6,8,11-12,16,21-23,26H,3-5,7,9-10,13-15,17-19H2,1-2H3,(H,32,40)(H,33,38)(H,34,39)/b8-6+ |
| InChIKey | NUWXIDWSJWQQCF-SOFGYWHQSA-N |
| XLogP | 1.20 |
| TPSA | 191.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.84 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|