C27H15N3 — CID 66870651
4-[2,3-bis(4-cyanophenyl)phenyl]benzonitrile (PubChem CID 66870651) has the molecular formula C27H15N3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 4-[2,3-bis(4-cyanophenyl)phenyl]benzonitrile.
| Compound Name | 4-[2,3-bis(4-cyanophenyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 66870651 |
| Molecular Formula | C27H15N3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 4-[2,3-bis(4-cyanophenyl)phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cccc(-c3ccc(C#N)cc3)c2-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C27H15N3/c28-16-19-4-10-22(11-5-19)25-2-1-3-26(23-12-6-20(17-29)7-13-23)27(25)24-14-8-21(18-30)9-15-24/h1-15H |
| InChIKey | JINLIWJLESDVQK-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |