C16H20N4O7S — CID 66870699
[(5R)-2-[(1-amino-1-oxo-3-phenylpropan-2-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 66870699) has the molecular formula C16H20N4O7S and a molecular weight of 412.42 g/mol. Its IUPAC name is [(5R)-2-[(1-amino-1-oxo-3-phenylpropan-2-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(5R)-2-[(1-amino-1-oxo-3-phenylpropan-2-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 66870699 |
| Molecular Formula | C16H20N4O7S |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | [(5R)-2-[(1-amino-1-oxo-3-phenylpropan-2-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NC(=O)C(Cc1ccccc1)NC(=O)C1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C16H20N4O7S/c17-14(21)12(8-10-4-2-1-3-5-10)18-15(22)13-7-6-11-9-19(13)16(23)20(11)27-28(24,25)26/h1-5,11-13H,6-9H2,(H2,17,21)(H,18,22)(H,24,25,26)/t11-,12?,13?/m1/s1 |
| InChIKey | PIZOUGRUMMZTOZ-PNESKVBLSA-N |
| XLogP | -0.80 |
| TPSA | 159.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|