About bis[(2,3-diethyl-4-methylphenyl)methoxy]-oxophosphanium
bis[(2,3-diethyl-4-methylphenyl)methoxy]-oxophosphanium (PubChem CID 66870745) has the molecular formula C24H34O3P+
and a molecular weight of 401.51 g/mol. Its IUPAC name is bis[(2,3-diethyl-4-methylphenyl)methoxy]-oxophosphanium.
Molecular Properties
| Compound Name | bis[(2,3-diethyl-4-methylphenyl)methoxy]-oxophosphanium |
| PubChem CID | 66870745 |
| Molecular Formula | C24H34O3P+ |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | bis[(2,3-diethyl-4-methylphenyl)methoxy]-oxophosphanium |
| SMILES | CCc1c(C)ccc(CO[P+](=O)OCc2ccc(C)c(CC)c2CC)c1CC |
| InChI | InChI=1S/C24H34O3P/c1-7-21-17(5)11-13-19(23(21)9-3)15-26-28(25)27-16-20-14-12-18(6)22(8-2)24(20)10-4/h11-14H,7-10,15-16H2,1-6H3/q+1 |
| InChIKey | CILAEEJNHLLYPB-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis[(2,3-diethyl-4-methylphenyl)methoxy]-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(2,3-diethyl-4-methylphenyl)methoxy]-oxophosphanium?
The IUPAC name of bis[(2,3-diethyl-4-methylphenyl)methoxy]-oxophosphanium (CID 66870745) is bis[(2,3-diethyl-4-methylphenyl)methoxy]-oxophosphanium.
What is the SMILES notation for bis[(2,3-diethyl-4-methylphenyl)methoxy]-oxophosphanium?
The canonical SMILES for bis[(2,3-diethyl-4-methylphenyl)methoxy]-oxophosphanium is CCc1c(C)ccc(CO[P+](=O)OCc2ccc(C)c(CC)c2CC)c1CC.
What is the InChIKey of bis[(2,3-diethyl-4-methylphenyl)methoxy]-oxophosphanium?
The InChIKey is CILAEEJNHLLYPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34O3P/c1-7-21-17(5)11-13-19(23(21)9-3)15-26-28(25)27-16-20-14-12-18(6)22(8-2)24(20)10-4/h11-14H,7-10,15-16H2,1-6H3/q+1.
What are the key properties of bis[(2,3-diethyl-4-methylphenyl)methoxy]-oxophosphanium?
bis[(2,3-diethyl-4-methylphenyl)methoxy]-oxophosphanium has a molecular weight of 401.51 g/mol, XLogP of 6.94, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(2,3-diethyl-4-methylphenyl)methoxy]-oxophosphanium is sourced from PubChem (CID 66870745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).