C42H49N5O7S — CID 66870926
ethyl (7E)-13-[(4-methoxyphenyl)methyl]-17-[7-methoxy-2-(4-propan-2-yl-1,3-thiazol-2-yl)quinolin-4-yl]oxy-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate (PubChem CID 66870926) has the molecular formula C42H49N5O7S and a molecular weight of 767.95 g/mol. Its IUPAC name is ethyl (7E)-13-[(4-methoxyphenyl)methyl]-17-[7-methoxy-2-(4-propan-2-yl-1,3-thiazol-2-yl)quinolin-4-yl]oxy-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate.
| Compound Name | ethyl (7E)-13-[(4-methoxyphenyl)methyl]-17-[7-methoxy-2-(4-propan-2-yl-1,3-thiazol-2-yl)quinolin-4-yl]oxy-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate |
|---|---|
| PubChem CID | 66870926 |
| Molecular Formula | C42H49N5O7S |
| Molecular Weight | 767.95 g/mol |
| Exact Mass | 767.34 |
| IUPAC Name | ethyl (7E)-13-[(4-methoxyphenyl)methyl]-17-[7-methoxy-2-(4-propan-2-yl-1,3-thiazol-2-yl)quinolin-4-yl]oxy-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate |
| SMILES | CCOC(=O)C12CC1/C=C/CCCCN(Cc1ccc(OC)cc1)C(=O)N1CC(Oc3cc(-c4nc(C(C)C)cs4)nc4cc(OC)ccc34)CC1C(=O)N2 |
| InChI | InChI=1S/C42H49N5O7S/c1-6-53-40(49)42-22-28(42)11-9-7-8-10-18-46(23-27-12-14-29(51-4)15-13-27)41(50)47-24-31(20-36(47)38(48)45-42)54-37-21-34(39-44-35(25-55-39)26(2)3)43-33-19-30(52-5)16-17-32(33)37/h9,11-17,19,21,25-26,28,31,36H,6-8,10,18,20,22-24H2,1-5H3,(H,45,48)/b11-9+ |
| InChIKey | PTJQGZRSOSSKCW-PKNBQFBNSA-N |
| XLogP | 7.12 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.95 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|