About tert-butyl 6-ethyl-6-methoxycyclohexa-2,4-diene-1-carboxylate
tert-butyl 6-ethyl-6-methoxycyclohexa-2,4-diene-1-carboxylate (PubChem CID 66871060) has the molecular formula C14H22O3
and a molecular weight of 238.33 g/mol. Its IUPAC name is tert-butyl 6-ethyl-6-methoxycyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 6-ethyl-6-methoxycyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 66871060 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | tert-butyl 6-ethyl-6-methoxycyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCC1(OC)C=CC=CC1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H22O3/c1-6-14(16-5)10-8-7-9-11(14)12(15)17-13(2,3)4/h7-11H,6H2,1-5H3 |
| InChIKey | YUBWSEXVHUEVLR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 6-ethyl-6-methoxycyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-ethyl-6-methoxycyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of tert-butyl 6-ethyl-6-methoxycyclohexa-2,4-diene-1-carboxylate (CID 66871060) is tert-butyl 6-ethyl-6-methoxycyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for tert-butyl 6-ethyl-6-methoxycyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for tert-butyl 6-ethyl-6-methoxycyclohexa-2,4-diene-1-carboxylate is CCC1(OC)C=CC=CC1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 6-ethyl-6-methoxycyclohexa-2,4-diene-1-carboxylate?
The InChIKey is YUBWSEXVHUEVLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O3/c1-6-14(16-5)10-8-7-9-11(14)12(15)17-13(2,3)4/h7-11H,6H2,1-5H3.
What are the key properties of tert-butyl 6-ethyl-6-methoxycyclohexa-2,4-diene-1-carboxylate?
tert-butyl 6-ethyl-6-methoxycyclohexa-2,4-diene-1-carboxylate has a molecular weight of 238.33 g/mol, XLogP of 2.87, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-ethyl-6-methoxycyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 66871060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).