C34H33F3N6O6 — CID 66871139
but-2-enedioic acid;1-[4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-3-(trifluoromethyl)phenyl]-8-(6-methoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-one (PubChem CID 66871139) has the molecular formula C34H33F3N6O6 and a molecular weight of 678.67 g/mol. Its IUPAC name is but-2-enedioic acid;1-[4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-3-(trifluoromethyl)phenyl]-8-(6-methoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-one.
| Compound Name | but-2-enedioic acid;1-[4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-3-(trifluoromethyl)phenyl]-8-(6-methoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-one |
|---|---|
| PubChem CID | 66871139 |
| Molecular Formula | C34H33F3N6O6 |
| Molecular Weight | 678.67 g/mol |
| Exact Mass | 678.24 |
| IUPAC Name | but-2-enedioic acid;1-[4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-3-(trifluoromethyl)phenyl]-8-(6-methoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-one |
| SMILES | COc1ccc(-c2ccc3ncc4c(c3c2)n(-c2ccc(N3C[C@@H](C)N[C@@H](C)C3)c(C(F)(F)F)c2)c(=O)n4C)cn1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C30H29F3N6O2.C4H4O4/c1-17-15-38(16-18(2)36-17)25-9-7-21(12-23(25)30(31,32)33)39-28-22-11-19(20-6-10-27(41-4)35-13-20)5-8-24(22)34-14-26(28)37(3)29(39)40;5-3(6)1-2-4(7)8/h5-14,17-18,36H,15-16H2,1-4H3;1-2H,(H,5,6)(H,7,8)/t17-,18+; |
| InChIKey | FDTHAGSYGKWNAI-GNXQHMNLSA-N |
| XLogP | 4.87 |
| TPSA | 151.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.67 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|