C24H44N2O4 — CID 66871450
6-oxo-5-(2,2,6,6-tetramethylpiperidin-4-yl)-6-(2,2,6,6-tetramethylpiperidin-4-yl)oxyhexanoic acid (PubChem CID 66871450) has the molecular formula C24H44N2O4 and a molecular weight of 424.63 g/mol. Its IUPAC name is 6-oxo-5-(2,2,6,6-tetramethylpiperidin-4-yl)-6-(2,2,6,6-tetramethylpiperidin-4-yl)oxyhexanoic acid.
| Compound Name | 6-oxo-5-(2,2,6,6-tetramethylpiperidin-4-yl)-6-(2,2,6,6-tetramethylpiperidin-4-yl)oxyhexanoic acid |
|---|---|
| PubChem CID | 66871450 |
| Molecular Formula | C24H44N2O4 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.33 |
| IUPAC Name | 6-oxo-5-(2,2,6,6-tetramethylpiperidin-4-yl)-6-(2,2,6,6-tetramethylpiperidin-4-yl)oxyhexanoic acid |
| SMILES | CC1(C)CC(OC(=O)C(CCCC(=O)O)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C24H44N2O4/c1-21(2)12-16(13-22(3,4)25-21)18(10-9-11-19(27)28)20(29)30-17-14-23(5,6)26-24(7,8)15-17/h16-18,25-26H,9-15H2,1-8H3,(H,27,28) |
| InChIKey | DPRFNJNGCTVNIU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |