C13H16O2 — CID 66871548
2,2-dimethyl-4,4a,4b,5-tetrahydroindeno[2,1-d][1,3]dioxine (PubChem CID 66871548) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2,2-dimethyl-4,4a,4b,5-tetrahydroindeno[2,1-d][1,3]dioxine.
| Compound Name | 2,2-dimethyl-4,4a,4b,5-tetrahydroindeno[2,1-d][1,3]dioxine |
|---|---|
| PubChem CID | 66871548 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 2,2-dimethyl-4,4a,4b,5-tetrahydroindeno[2,1-d][1,3]dioxine |
| SMILES | CC1(C)OCC2C(=CC3=CC=CCC32)O1 |
| InChI | InChI=1S/C13H16O2/c1-13(2)14-8-11-10-6-4-3-5-9(10)7-12(11)15-13/h3-5,7,10-11H,6,8H2,1-2H3 |
| InChIKey | FTZRHRHOHBXUGL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |