C23H20F3N3O — CID 66872758
(3,4-difluorophenyl)-[5-[[4-(6-fluoro-3-pyridinyl)piperidin-1-yl]methyl]-2-pyridinyl]methanone (PubChem CID 66872758) has the molecular formula C23H20F3N3O and a molecular weight of 411.43 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[5-[[4-(6-fluoro-3-pyridinyl)piperidin-1-yl]methyl]-2-pyridinyl]methanone.
| Compound Name | (3,4-difluorophenyl)-[5-[[4-(6-fluoro-3-pyridinyl)piperidin-1-yl]methyl]-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 66872758 |
| Molecular Formula | C23H20F3N3O |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (3,4-difluorophenyl)-[5-[[4-(6-fluoro-3-pyridinyl)piperidin-1-yl]methyl]-2-pyridinyl]methanone |
| SMILES | O=C(c1ccc(F)c(F)c1)c1ccc(CN2CCC(c3ccc(F)nc3)CC2)cn1 |
| InChI | InChI=1S/C23H20F3N3O/c24-19-4-2-17(11-20(19)25)23(30)21-5-1-15(12-27-21)14-29-9-7-16(8-10-29)18-3-6-22(26)28-13-18/h1-6,11-13,16H,7-10,14H2 |
| InChIKey | IASTXGQQVZJSMB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|