About spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine];dihydrochloride
spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine];dihydrochloride (PubChem CID 66873209) has the molecular formula C11H16Cl2N2O
and a molecular weight of 263.17 g/mol. Its IUPAC name is spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine];dihydrochloride.
Molecular Properties
| Compound Name | spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine];dihydrochloride |
| PubChem CID | 66873209 |
| Molecular Formula | C11H16Cl2N2O |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine];dihydrochloride |
| SMILES | Cl.Cl.c1cc2c(cn1)C1(CCNCC1)OC2 |
| InChI | InChI=1S/C11H14N2O.2ClH/c1-4-13-7-10-9(1)8-14-11(10)2-5-12-6-3-11;;/h1,4,7,12H,2-3,5-6,8H2;2*1H |
| InChIKey | SUPFIUOBNYIFMA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine];dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine];dihydrochloride?
The IUPAC name of spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine];dihydrochloride (CID 66873209) is spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine];dihydrochloride.
What is the SMILES notation for spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine];dihydrochloride?
The canonical SMILES for spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine];dihydrochloride is Cl.Cl.c1cc2c(cn1)C1(CCNCC1)OC2.
What is the InChIKey of spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine];dihydrochloride?
The InChIKey is SUPFIUOBNYIFMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O.2ClH/c1-4-13-7-10-9(1)8-14-11(10)2-5-12-6-3-11;;/h1,4,7,12H,2-3,5-6,8H2;2*1H.
What are the key properties of spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine];dihydrochloride?
spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine];dihydrochloride has a molecular weight of 263.17 g/mol, XLogP of 2.03, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine];dihydrochloride is sourced from PubChem (CID 66873209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).