About ethyl 1,4-bis(methylamino)cyclohexa-2,4-diene-1-carboxylate
ethyl 1,4-bis(methylamino)cyclohexa-2,4-diene-1-carboxylate (PubChem CID 66873586) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is ethyl 1,4-bis(methylamino)cyclohexa-2,4-diene-1-carboxylate.
Analyze ethyl 1,4-bis(methylamino)cyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1,4-bis(methylamino)cyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of ethyl 1,4-bis(methylamino)cyclohexa-2,4-diene-1-carboxylate (CID 66873586) is ethyl 1,4-bis(methylamino)cyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for ethyl 1,4-bis(methylamino)cyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for ethyl 1,4-bis(methylamino)cyclohexa-2,4-diene-1-carboxylate is CCOC(=O)C1(NC)C=CC(NC)=CC1.
What is the InChIKey of ethyl 1,4-bis(methylamino)cyclohexa-2,4-diene-1-carboxylate?
The InChIKey is QJNWJBHJIZIDSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2/c1-4-15-10(14)11(13-3)7-5-9(12-2)6-8-11/h5-7,12-13H,4,8H2,1-3H3.
What are the key properties of ethyl 1,4-bis(methylamino)cyclohexa-2,4-diene-1-carboxylate?
ethyl 1,4-bis(methylamino)cyclohexa-2,4-diene-1-carboxylate has a molecular weight of 210.28 g/mol, XLogP of 0.57, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1,4-bis(methylamino)cyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 66873586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).