C23H21F2N5O2 — CID 66873755
4-[(3,5-difluoro-2-pyridinyl)methoxy]-1-(8-methyl-6,8,13-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-5-yl)pyridin-2-one (PubChem CID 66873755) has the molecular formula C23H21F2N5O2 and a molecular weight of 437.45 g/mol. Its IUPAC name is 4-[(3,5-difluoro-2-pyridinyl)methoxy]-1-(8-methyl-6,8,13-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-5-yl)pyridin-2-one.
| Compound Name | 4-[(3,5-difluoro-2-pyridinyl)methoxy]-1-(8-methyl-6,8,13-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-5-yl)pyridin-2-one |
|---|---|
| PubChem CID | 66873755 |
| Molecular Formula | C23H21F2N5O2 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 4-[(3,5-difluoro-2-pyridinyl)methoxy]-1-(8-methyl-6,8,13-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-5-yl)pyridin-2-one |
| SMILES | Cn1c2c(c3ccc(-n4ccc(OCc5ncc(F)cc5F)cc4=O)nc31)CNCCC2 |
| InChI | InChI=1S/C23H21F2N5O2/c1-29-20-3-2-7-26-12-17(20)16-4-5-21(28-23(16)29)30-8-6-15(10-22(30)31)32-13-19-18(25)9-14(24)11-27-19/h4-6,8-11,26H,2-3,7,12-13H2,1H3 |
| InChIKey | YDCLNMDWUXIIEU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |