C23H33N5O2S — CID 66874331
5-ethyl-2-[4-[4-[(4-methylsulfinylpiperazin-1-yl)methyl]phenoxy]piperidin-1-yl]pyrimidine (PubChem CID 66874331) has the molecular formula C23H33N5O2S and a molecular weight of 443.62 g/mol. Its IUPAC name is 5-ethyl-2-[4-[4-[(4-methylsulfinylpiperazin-1-yl)methyl]phenoxy]piperidin-1-yl]pyrimidine.
| Compound Name | 5-ethyl-2-[4-[4-[(4-methylsulfinylpiperazin-1-yl)methyl]phenoxy]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 66874331 |
| Molecular Formula | C23H33N5O2S |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 5-ethyl-2-[4-[4-[(4-methylsulfinylpiperazin-1-yl)methyl]phenoxy]piperidin-1-yl]pyrimidine |
| SMILES | CCc1cnc(N2CCC(Oc3ccc(CN4CCN(S(C)=O)CC4)cc3)CC2)nc1 |
| InChI | InChI=1S/C23H33N5O2S/c1-3-19-16-24-23(25-17-19)27-10-8-22(9-11-27)30-21-6-4-20(5-7-21)18-26-12-14-28(15-13-26)31(2)29/h4-7,16-17,22H,3,8-15,18H2,1-2H3 |
| InChIKey | BPOINBYRMJYFQA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |