C14H19F3N2O2 — CID 66874892
methyl 5-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]pentanoate (PubChem CID 66874892) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is methyl 5-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]pentanoate.
| Compound Name | methyl 5-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]pentanoate |
|---|---|
| PubChem CID | 66874892 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | methyl 5-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]pentanoate |
| SMILES | COC(=O)CCCCn1nc(C(F)(F)F)c2c1CCCC2 |
| InChI | InChI=1S/C14H19F3N2O2/c1-21-12(20)8-4-5-9-19-11-7-3-2-6-10(11)13(18-19)14(15,16)17/h2-9H2,1H3 |
| InChIKey | YTOOWGPQHAZNER-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|