About 3-[6-[(2,3-difluorophenyl)methoxy]hexylcarbamoylamino]-4-(dimethylamino)butanoic acid
3-[6-[(2,3-difluorophenyl)methoxy]hexylcarbamoylamino]-4-(dimethylamino)butanoic acid (PubChem CID 66874973) has the molecular formula C20H31F2N3O4
and a molecular weight of 415.48 g/mol. Its IUPAC name is 3-[6-[(2,3-difluorophenyl)methoxy]hexylcarbamoylamino]-4-(dimethylamino)butanoic acid.
Molecular Properties
| Compound Name | 3-[6-[(2,3-difluorophenyl)methoxy]hexylcarbamoylamino]-4-(dimethylamino)butanoic acid |
| PubChem CID | 66874973 |
| Molecular Formula | C20H31F2N3O4 |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3-[6-[(2,3-difluorophenyl)methoxy]hexylcarbamoylamino]-4-(dimethylamino)butanoic acid |
| SMILES | CN(C)CC(CC(=O)O)NC(=O)NCCCCCCOCc1cccc(F)c1F |
| InChI | InChI=1S/C20H31F2N3O4/c1-25(2)13-16(12-18(26)27)24-20(28)23-10-5-3-4-6-11-29-14-15-8-7-9-17(21)19(15)22/h7-9,16H,3-6,10-14H2,1-2H3,(H,26,27)(H2,23,24,28) |
| InChIKey | HBCMDYOUAZFZQN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[6-[(2,3-difluorophenyl)methoxy]hexylcarbamoylamino]-4-(dimethylamino)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-[(2,3-difluorophenyl)methoxy]hexylcarbamoylamino]-4-(dimethylamino)butanoic acid?
The IUPAC name of 3-[6-[(2,3-difluorophenyl)methoxy]hexylcarbamoylamino]-4-(dimethylamino)butanoic acid (CID 66874973) is 3-[6-[(2,3-difluorophenyl)methoxy]hexylcarbamoylamino]-4-(dimethylamino)butanoic acid.
What is the SMILES notation for 3-[6-[(2,3-difluorophenyl)methoxy]hexylcarbamoylamino]-4-(dimethylamino)butanoic acid?
The canonical SMILES for 3-[6-[(2,3-difluorophenyl)methoxy]hexylcarbamoylamino]-4-(dimethylamino)butanoic acid is CN(C)CC(CC(=O)O)NC(=O)NCCCCCCOCc1cccc(F)c1F.
What is the InChIKey of 3-[6-[(2,3-difluorophenyl)methoxy]hexylcarbamoylamino]-4-(dimethylamino)butanoic acid?
The InChIKey is HBCMDYOUAZFZQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31F2N3O4/c1-25(2)13-16(12-18(26)27)24-20(28)23-10-5-3-4-6-11-29-14-15-8-7-9-17(21)19(15)22/h7-9,16H,3-6,10-14H2,1-2H3,(H,26,27)(H2,23,24,28).
What are the key properties of 3-[6-[(2,3-difluorophenyl)methoxy]hexylcarbamoylamino]-4-(dimethylamino)butanoic acid?
3-[6-[(2,3-difluorophenyl)methoxy]hexylcarbamoylamino]-4-(dimethylamino)butanoic acid has a molecular weight of 415.48 g/mol, XLogP of 2.75, 14 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-[(2,3-difluorophenyl)methoxy]hexylcarbamoylamino]-4-(dimethylamino)butanoic acid is sourced from PubChem (CID 66874973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).