About 2-(3,3a-dihydro-2H-cyclopenta[b]pyrrol-1-yl)acetamide
2-(3,3a-dihydro-2H-cyclopenta[b]pyrrol-1-yl)acetamide (PubChem CID 66875208) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 2-(3,3a-dihydro-2H-cyclopenta[b]pyrrol-1-yl)acetamide.
Molecular Properties
| Compound Name | 2-(3,3a-dihydro-2H-cyclopenta[b]pyrrol-1-yl)acetamide |
| PubChem CID | 66875208 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 2-(3,3a-dihydro-2H-cyclopenta[b]pyrrol-1-yl)acetamide |
| SMILES | NC(=O)CN1CCC2C=CC=C21 |
| InChI | InChI=1S/C9H12N2O/c10-9(12)6-11-5-4-7-2-1-3-8(7)11/h1-3,7H,4-6H2,(H2,10,12) |
| InChIKey | AXKYUFWSUKUGDO-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,3a-dihydro-2H-cyclopenta[b]pyrrol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3a-dihydro-2H-cyclopenta[b]pyrrol-1-yl)acetamide?
The IUPAC name of 2-(3,3a-dihydro-2H-cyclopenta[b]pyrrol-1-yl)acetamide (CID 66875208) is 2-(3,3a-dihydro-2H-cyclopenta[b]pyrrol-1-yl)acetamide.
What is the SMILES notation for 2-(3,3a-dihydro-2H-cyclopenta[b]pyrrol-1-yl)acetamide?
The canonical SMILES for 2-(3,3a-dihydro-2H-cyclopenta[b]pyrrol-1-yl)acetamide is NC(=O)CN1CCC2C=CC=C21.
What is the InChIKey of 2-(3,3a-dihydro-2H-cyclopenta[b]pyrrol-1-yl)acetamide?
The InChIKey is AXKYUFWSUKUGDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c10-9(12)6-11-5-4-7-2-1-3-8(7)11/h1-3,7H,4-6H2,(H2,10,12).
What are the key properties of 2-(3,3a-dihydro-2H-cyclopenta[b]pyrrol-1-yl)acetamide?
2-(3,3a-dihydro-2H-cyclopenta[b]pyrrol-1-yl)acetamide has a molecular weight of 164.21 g/mol, XLogP of 0.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3a-dihydro-2H-cyclopenta[b]pyrrol-1-yl)acetamide is sourced from PubChem (CID 66875208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).