C26H28N2O5 — CID 66875351
ethyl 2-[3-[2-[[methyl(2-phenylethyl)amino]methyl]-4-nitrophenoxy]phenyl]acetate (PubChem CID 66875351) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is ethyl 2-[3-[2-[[methyl(2-phenylethyl)amino]methyl]-4-nitrophenoxy]phenyl]acetate.
| Compound Name | ethyl 2-[3-[2-[[methyl(2-phenylethyl)amino]methyl]-4-nitrophenoxy]phenyl]acetate |
|---|---|
| PubChem CID | 66875351 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | ethyl 2-[3-[2-[[methyl(2-phenylethyl)amino]methyl]-4-nitrophenoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1cccc(Oc2ccc([N+](=O)[O-])cc2CN(C)CCc2ccccc2)c1 |
| InChI | InChI=1S/C26H28N2O5/c1-3-32-26(29)17-21-10-7-11-24(16-21)33-25-13-12-23(28(30)31)18-22(25)19-27(2)15-14-20-8-5-4-6-9-20/h4-13,16,18H,3,14-15,17,19H2,1-2H3 |
| InChIKey | PKIATRKZCKCBLJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|