C22H27NO — CID 66875589
2-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1,1-diphenylethanol (PubChem CID 66875589) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is 2-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1,1-diphenylethanol.
| Compound Name | 2-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1,1-diphenylethanol |
|---|---|
| PubChem CID | 66875589 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 2-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-1,1-diphenylethanol |
| SMILES | CN1[C@@H]2CC[C@H]1CC(CC(O)(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C22H27NO/c1-23-20-12-13-21(23)15-17(14-20)16-22(24,18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,17,20-21,24H,12-16H2,1H3/t17?,20-,21+ |
| InChIKey | LAOBIJDCKIAALB-PRJVBOEPSA-N |
| XLogP | 4.19 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |