C14H15NO — CID 66876135
8-(furan-2-yl)-1-methyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 66876135) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is 8-(furan-2-yl)-1-methyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 8-(furan-2-yl)-1-methyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 66876135 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 8-(furan-2-yl)-1-methyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC1NCCc2cccc(-c3ccco3)c21 |
| InChI | InChI=1S/C14H15NO/c1-10-14-11(7-8-15-10)4-2-5-12(14)13-6-3-9-16-13/h2-6,9-10,15H,7-8H2,1H3 |
| InChIKey | RAXVODLWHAUWOL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |