About oxalic acid;1H-pyrazol-5-amine
oxalic acid;1H-pyrazol-5-amine (PubChem CID 66876577) has the molecular formula C5H7N3O4
and a molecular weight of 173.13 g/mol. Its IUPAC name is oxalic acid;1H-pyrazol-5-amine.
Molecular Properties
| Compound Name | oxalic acid;1H-pyrazol-5-amine |
| PubChem CID | 66876577 |
| Molecular Formula | C5H7N3O4 |
| Molecular Weight | 173.13 g/mol |
| Exact Mass | 173.04 |
| IUPAC Name | oxalic acid;1H-pyrazol-5-amine |
| SMILES | Nc1ccn[nH]1.O=C(O)C(=O)O |
| InChI | InChI=1S/C3H5N3.C2H2O4/c4-3-1-2-5-6-3;3-1(4)2(5)6/h1-2H,(H3,4,5,6);(H,3,4)(H,5,6) |
| InChIKey | ALPRYOAPIKMIBK-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 129.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.13 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze oxalic acid;1H-pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxalic acid;1H-pyrazol-5-amine?
The IUPAC name of oxalic acid;1H-pyrazol-5-amine (CID 66876577) is oxalic acid;1H-pyrazol-5-amine.
What is the SMILES notation for oxalic acid;1H-pyrazol-5-amine?
The canonical SMILES for oxalic acid;1H-pyrazol-5-amine is Nc1ccn[nH]1.O=C(O)C(=O)O.
What is the InChIKey of oxalic acid;1H-pyrazol-5-amine?
The InChIKey is ALPRYOAPIKMIBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N3.C2H2O4/c4-3-1-2-5-6-3;3-1(4)2(5)6/h1-2H,(H3,4,5,6);(H,3,4)(H,5,6).
What are the key properties of oxalic acid;1H-pyrazol-5-amine?
oxalic acid;1H-pyrazol-5-amine has a molecular weight of 173.13 g/mol, XLogP of -0.85, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxalic acid;1H-pyrazol-5-amine is sourced from PubChem (CID 66876577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).