C28H25F3N2O2 — CID 66876711
methyl 3-[2-methyl-5-(1-methylindazol-5-yl)-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]propanoate (PubChem CID 66876711) has the molecular formula C28H25F3N2O2 and a molecular weight of 478.51 g/mol. Its IUPAC name is methyl 3-[2-methyl-5-(1-methylindazol-5-yl)-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]propanoate.
| Compound Name | methyl 3-[2-methyl-5-(1-methylindazol-5-yl)-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]propanoate |
|---|---|
| PubChem CID | 66876711 |
| Molecular Formula | C28H25F3N2O2 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | methyl 3-[2-methyl-5-(1-methylindazol-5-yl)-4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]propanoate |
| SMILES | COC(=O)CCc1cc(-c2ccc3c(cnn3C)c2)c(/C=C/c2ccc(C(F)(F)F)cc2)cc1C |
| InChI | InChI=1S/C28H25F3N2O2/c1-18-14-21(7-4-19-5-10-24(11-6-19)28(29,30)31)25(16-20(18)9-13-27(34)35-3)22-8-12-26-23(15-22)17-32-33(26)2/h4-8,10-12,14-17H,9,13H2,1-3H3/b7-4+ |
| InChIKey | XAFSOSFRYUNIII-QPJJXVBHSA-N |
| XLogP | 6.84 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|