About bis(3-hydroxypyrrolidine-2,5-dione);triazine
bis(3-hydroxypyrrolidine-2,5-dione);triazine (PubChem CID 66877160) has the molecular formula C11H13N5O6
and a molecular weight of 311.25 g/mol. Its IUPAC name is bis(3-hydroxypyrrolidine-2,5-dione);triazine.
Molecular Properties
| Compound Name | bis(3-hydroxypyrrolidine-2,5-dione);triazine |
| PubChem CID | 66877160 |
| Molecular Formula | C11H13N5O6 |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | bis(3-hydroxypyrrolidine-2,5-dione);triazine |
| SMILES | O=C1CC(O)C(=O)N1.O=C1CC(O)C(=O)N1.c1cnnnc1 |
| InChI | InChI=1S/2C4H5NO3.C3H3N3/c2*6-2-1-3(7)5-4(2)8;1-2-4-6-5-3-1/h2*2,6H,1H2,(H,5,7,8);1-3H |
| InChIKey | AXIDXMGERUUDDI-UHFFFAOYSA-N |
| XLogP | -3.34 |
| TPSA | 171.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze bis(3-hydroxypyrrolidine-2,5-dione);triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-hydroxypyrrolidine-2,5-dione);triazine?
The IUPAC name of bis(3-hydroxypyrrolidine-2,5-dione);triazine (CID 66877160) is bis(3-hydroxypyrrolidine-2,5-dione);triazine.
What is the SMILES notation for bis(3-hydroxypyrrolidine-2,5-dione);triazine?
The canonical SMILES for bis(3-hydroxypyrrolidine-2,5-dione);triazine is O=C1CC(O)C(=O)N1.O=C1CC(O)C(=O)N1.c1cnnnc1.
What is the InChIKey of bis(3-hydroxypyrrolidine-2,5-dione);triazine?
The InChIKey is AXIDXMGERUUDDI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H5NO3.C3H3N3/c2*6-2-1-3(7)5-4(2)8;1-2-4-6-5-3-1/h2*2,6H,1H2,(H,5,7,8);1-3H.
What are the key properties of bis(3-hydroxypyrrolidine-2,5-dione);triazine?
bis(3-hydroxypyrrolidine-2,5-dione);triazine has a molecular weight of 311.25 g/mol, XLogP of -3.34, 0 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-hydroxypyrrolidine-2,5-dione);triazine is sourced from PubChem (CID 66877160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).