C30H30N8O2S — CID 66877490
4-morpholin-4-yl-1-[3-[[1-(pyridin-2-ylmethyl)indazol-5-yl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one (PubChem CID 66877490) has the molecular formula C30H30N8O2S and a molecular weight of 566.69 g/mol. Its IUPAC name is 4-morpholin-4-yl-1-[3-[[1-(pyridin-2-ylmethyl)indazol-5-yl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one.
| Compound Name | 4-morpholin-4-yl-1-[3-[[1-(pyridin-2-ylmethyl)indazol-5-yl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 66877490 |
| Molecular Formula | C30H30N8O2S |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | 4-morpholin-4-yl-1-[3-[[1-(pyridin-2-ylmethyl)indazol-5-yl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
| SMILES | O=C(C=CCN1CCOCC1)N1CCc2c(sc3ncnc(Nc4ccc5c(cnn5Cc5ccccn5)c4)c23)C1 |
| InChI | InChI=1S/C30H30N8O2S/c39-27(5-3-10-36-12-14-40-15-13-36)37-11-8-24-26(19-37)41-30-28(24)29(32-20-33-30)35-22-6-7-25-21(16-22)17-34-38(25)18-23-4-1-2-9-31-23/h1-7,9,16-17,20H,8,10-15,18-19H2,(H,32,33,35) |
| InChIKey | AOYPOHZXFAIVCB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|