C18H13BrClN3O — CID 66877640
6-(bromomethyl)-N-(4-chloro-3-pyridin-2-ylphenyl)pyridine-3-carboxamide (PubChem CID 66877640) has the molecular formula C18H13BrClN3O and a molecular weight of 402.68 g/mol. Its IUPAC name is 6-(bromomethyl)-N-(4-chloro-3-pyridin-2-ylphenyl)pyridine-3-carboxamide.
| Compound Name | 6-(bromomethyl)-N-(4-chloro-3-pyridin-2-ylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66877640 |
| Molecular Formula | C18H13BrClN3O |
| Molecular Weight | 402.68 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | 6-(bromomethyl)-N-(4-chloro-3-pyridin-2-ylphenyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(-c2ccccn2)c1)c1ccc(CBr)nc1 |
| InChI | InChI=1S/C18H13BrClN3O/c19-10-14-5-4-12(11-22-14)18(24)23-13-6-7-16(20)15(9-13)17-3-1-2-8-21-17/h1-9,11H,10H2,(H,23,24) |
| InChIKey | QQUCVNSMHSTABD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.68 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|