C22H25N5OS — CID 66877868
4-(dimethylamino)-1-[3-(3-methylanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one (PubChem CID 66877868) has the molecular formula C22H25N5OS and a molecular weight of 407.54 g/mol. Its IUPAC name is 4-(dimethylamino)-1-[3-(3-methylanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one.
| Compound Name | 4-(dimethylamino)-1-[3-(3-methylanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 66877868 |
| Molecular Formula | C22H25N5OS |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 4-(dimethylamino)-1-[3-(3-methylanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
| SMILES | Cc1cccc(Nc2ncnc3sc4c(c23)CCN(C(=O)C=CCN(C)C)C4)c1 |
| InChI | InChI=1S/C22H25N5OS/c1-15-6-4-7-16(12-15)25-21-20-17-9-11-27(19(28)8-5-10-26(2)3)13-18(17)29-22(20)24-14-23-21/h4-8,12,14H,9-11,13H2,1-3H3,(H,23,24,25) |
| InChIKey | HBKNPHYZXACWHI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|