C17H25ClN4O2 — CID 66878377
1-cyclobutyl-3-[4-[(2S)-2-methylpiperazine-1-carbonyl]phenyl]urea;hydrochloride (PubChem CID 66878377) has the molecular formula C17H25ClN4O2 and a molecular weight of 352.87 g/mol. Its IUPAC name is 1-cyclobutyl-3-[4-[(2S)-2-methylpiperazine-1-carbonyl]phenyl]urea;hydrochloride.
| Compound Name | 1-cyclobutyl-3-[4-[(2S)-2-methylpiperazine-1-carbonyl]phenyl]urea;hydrochloride |
|---|---|
| PubChem CID | 66878377 |
| Molecular Formula | C17H25ClN4O2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 1-cyclobutyl-3-[4-[(2S)-2-methylpiperazine-1-carbonyl]phenyl]urea;hydrochloride |
| SMILES | C[C@H]1CNCCN1C(=O)c1ccc(NC(=O)NC2CCC2)cc1.Cl |
| InChI | InChI=1S/C17H24N4O2.ClH/c1-12-11-18-9-10-21(12)16(22)13-5-7-15(8-6-13)20-17(23)19-14-3-2-4-14;/h5-8,12,14,18H,2-4,9-11H2,1H3,(H2,19,20,23);1H/t12-;/m0./s1 |
| InChIKey | DJXHAYWQOPTLDJ-YDALLXLXSA-N |
| XLogP | 2.22 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |