C14H19FN4S — CID 66878732
N'-[3-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]pentane-1,5-diamine (PubChem CID 66878732) has the molecular formula C14H19FN4S and a molecular weight of 294.40 g/mol. Its IUPAC name is N'-[3-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]pentane-1,5-diamine.
| Compound Name | N'-[3-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 66878732 |
| Molecular Formula | C14H19FN4S |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | N'-[3-[(3-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]pentane-1,5-diamine |
| SMILES | NCCCCCNc1nc(Cc2cccc(F)c2)ns1 |
| InChI | InChI=1S/C14H19FN4S/c15-12-6-4-5-11(9-12)10-13-18-14(20-19-13)17-8-3-1-2-7-16/h4-6,9H,1-3,7-8,10,16H2,(H,17,18,19) |
| InChIKey | BBSMEGBXHCREHZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|