About 4-phenyl-2,6-dipropylphenol
4-phenyl-2,6-dipropylphenol (PubChem CID 66879307) has the molecular formula C18H22O
and a molecular weight of 254.37 g/mol. Its IUPAC name is 4-phenyl-2,6-dipropylphenol.
Molecular Properties
| Compound Name | 4-phenyl-2,6-dipropylphenol |
| PubChem CID | 66879307 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 4-phenyl-2,6-dipropylphenol |
| SMILES | CCCc1cc(-c2ccccc2)cc(CCC)c1O |
| InChI | InChI=1S/C18H22O/c1-3-8-15-12-17(14-10-6-5-7-11-14)13-16(9-4-2)18(15)19/h5-7,10-13,19H,3-4,8-9H2,1-2H3 |
| InChIKey | KHJZYKRUOFKZRV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-phenyl-2,6-dipropylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-2,6-dipropylphenol?
The IUPAC name of 4-phenyl-2,6-dipropylphenol (CID 66879307) is 4-phenyl-2,6-dipropylphenol.
What is the SMILES notation for 4-phenyl-2,6-dipropylphenol?
The canonical SMILES for 4-phenyl-2,6-dipropylphenol is CCCc1cc(-c2ccccc2)cc(CCC)c1O.
What is the InChIKey of 4-phenyl-2,6-dipropylphenol?
The InChIKey is KHJZYKRUOFKZRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O/c1-3-8-15-12-17(14-10-6-5-7-11-14)13-16(9-4-2)18(15)19/h5-7,10-13,19H,3-4,8-9H2,1-2H3.
What are the key properties of 4-phenyl-2,6-dipropylphenol?
4-phenyl-2,6-dipropylphenol has a molecular weight of 254.37 g/mol, XLogP of 4.96, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-2,6-dipropylphenol is sourced from PubChem (CID 66879307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).