C16H24N4S — CID 66879392
N'-[3-[(3-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]hexane-1,6-diamine (PubChem CID 66879392) has the molecular formula C16H24N4S and a molecular weight of 304.46 g/mol. Its IUPAC name is N'-[3-[(3-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]hexane-1,6-diamine.
| Compound Name | N'-[3-[(3-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 66879392 |
| Molecular Formula | C16H24N4S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | N'-[3-[(3-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]hexane-1,6-diamine |
| SMILES | Cc1cccc(Cc2nsc(NCCCCCCN)n2)c1 |
| InChI | InChI=1S/C16H24N4S/c1-13-7-6-8-14(11-13)12-15-19-16(21-20-15)18-10-5-3-2-4-9-17/h6-8,11H,2-5,9-10,12,17H2,1H3,(H,18,19,20) |
| InChIKey | CVPPHRLXCBLGLS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|