About 3-fluoro-4-[[(1R,5S)-8-(2-methoxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]aniline
3-fluoro-4-[[(1R,5S)-8-(2-methoxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]aniline (PubChem CID 66879478) has the molecular formula C16H23FN2O2
and a molecular weight of 294.37 g/mol. Its IUPAC name is 3-fluoro-4-[[(1R,5S)-8-(2-methoxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]aniline.
Molecular Properties
| Compound Name | 3-fluoro-4-[[(1R,5S)-8-(2-methoxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]aniline |
| PubChem CID | 66879478 |
| Molecular Formula | C16H23FN2O2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 3-fluoro-4-[[(1R,5S)-8-(2-methoxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]aniline |
| SMILES | COCCN1[C@@H]2CC[C@H]1CC(Oc1ccc(N)cc1F)C2 |
| InChI | InChI=1S/C16H23FN2O2/c1-20-7-6-19-12-3-4-13(19)10-14(9-12)21-16-5-2-11(18)8-15(16)17/h2,5,8,12-14H,3-4,6-7,9-10,18H2,1H3/t12-,13+,14? |
| InChIKey | JXXLIYGHBZXADH-PBWFPOADSA-N |
| XLogP | 2.43 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-4-[[(1R,5S)-8-(2-methoxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-[[(1R,5S)-8-(2-methoxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]aniline?
The IUPAC name of 3-fluoro-4-[[(1R,5S)-8-(2-methoxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]aniline (CID 66879478) is 3-fluoro-4-[[(1R,5S)-8-(2-methoxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]aniline.
What is the SMILES notation for 3-fluoro-4-[[(1R,5S)-8-(2-methoxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]aniline?
The canonical SMILES for 3-fluoro-4-[[(1R,5S)-8-(2-methoxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]aniline is COCCN1[C@@H]2CC[C@H]1CC(Oc1ccc(N)cc1F)C2.
What is the InChIKey of 3-fluoro-4-[[(1R,5S)-8-(2-methoxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]aniline?
The InChIKey is JXXLIYGHBZXADH-PBWFPOADSA-N. The full InChI is InChI=1S/C16H23FN2O2/c1-20-7-6-19-12-3-4-13(19)10-14(9-12)21-16-5-2-11(18)8-15(16)17/h2,5,8,12-14H,3-4,6-7,9-10,18H2,1H3/t12-,13+,14?.
What are the key properties of 3-fluoro-4-[[(1R,5S)-8-(2-methoxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]aniline?
3-fluoro-4-[[(1R,5S)-8-(2-methoxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]aniline has a molecular weight of 294.37 g/mol, XLogP of 2.43, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-[[(1R,5S)-8-(2-methoxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]aniline is sourced from PubChem (CID 66879478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).