About acetic acid;[1-(5-cyano-2-pyridinyl)piperidin-4-yl] 2,2,2-trifluoroacetate
acetic acid;[1-(5-cyano-2-pyridinyl)piperidin-4-yl] 2,2,2-trifluoroacetate (PubChem CID 66879710) has the molecular formula C15H16F3N3O4
and a molecular weight of 359.30 g/mol. Its IUPAC name is acetic acid;[1-(5-cyano-2-pyridinyl)piperidin-4-yl] 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | acetic acid;[1-(5-cyano-2-pyridinyl)piperidin-4-yl] 2,2,2-trifluoroacetate |
| PubChem CID | 66879710 |
| Molecular Formula | C15H16F3N3O4 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | acetic acid;[1-(5-cyano-2-pyridinyl)piperidin-4-yl] 2,2,2-trifluoroacetate |
| SMILES | CC(=O)O.N#Cc1ccc(N2CCC(OC(=O)C(F)(F)F)CC2)nc1 |
| InChI | InChI=1S/C13H12F3N3O2.C2H4O2/c14-13(15,16)12(20)21-10-3-5-19(6-4-10)11-2-1-9(7-17)8-18-11;1-2(3)4/h1-2,8,10H,3-6H2;1H3,(H,3,4) |
| InChIKey | QWPLBTPPADSEBL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze acetic acid;[1-(5-cyano-2-pyridinyl)piperidin-4-yl] 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;[1-(5-cyano-2-pyridinyl)piperidin-4-yl] 2,2,2-trifluoroacetate?
The IUPAC name of acetic acid;[1-(5-cyano-2-pyridinyl)piperidin-4-yl] 2,2,2-trifluoroacetate (CID 66879710) is acetic acid;[1-(5-cyano-2-pyridinyl)piperidin-4-yl] 2,2,2-trifluoroacetate.
What is the SMILES notation for acetic acid;[1-(5-cyano-2-pyridinyl)piperidin-4-yl] 2,2,2-trifluoroacetate?
The canonical SMILES for acetic acid;[1-(5-cyano-2-pyridinyl)piperidin-4-yl] 2,2,2-trifluoroacetate is CC(=O)O.N#Cc1ccc(N2CCC(OC(=O)C(F)(F)F)CC2)nc1.
What is the InChIKey of acetic acid;[1-(5-cyano-2-pyridinyl)piperidin-4-yl] 2,2,2-trifluoroacetate?
The InChIKey is QWPLBTPPADSEBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F3N3O2.C2H4O2/c14-13(15,16)12(20)21-10-3-5-19(6-4-10)11-2-1-9(7-17)8-18-11;1-2(3)4/h1-2,8,10H,3-6H2;1H3,(H,3,4).
What are the key properties of acetic acid;[1-(5-cyano-2-pyridinyl)piperidin-4-yl] 2,2,2-trifluoroacetate?
acetic acid;[1-(5-cyano-2-pyridinyl)piperidin-4-yl] 2,2,2-trifluoroacetate has a molecular weight of 359.30 g/mol, XLogP of 2.12, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;[1-(5-cyano-2-pyridinyl)piperidin-4-yl] 2,2,2-trifluoroacetate is sourced from PubChem (CID 66879710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).