C25H25FIN7O4 — CID 66880052
N-[1-[[4-[4-(6-amino-5-methoxy-3-pyridinyl)-2-(4-fluorophenyl)-1,3-oxazol-5-yl]pyrimidin-2-yl]amino]-1-iodopropan-2-yl]-2-methoxyacetamide (PubChem CID 66880052) has the molecular formula C25H25FIN7O4 and a molecular weight of 633.42 g/mol. Its IUPAC name is N-[1-[[4-[4-(6-amino-5-methoxy-3-pyridinyl)-2-(4-fluorophenyl)-1,3-oxazol-5-yl]pyrimidin-2-yl]amino]-1-iodopropan-2-yl]-2-methoxyacetamide.
| Compound Name | N-[1-[[4-[4-(6-amino-5-methoxy-3-pyridinyl)-2-(4-fluorophenyl)-1,3-oxazol-5-yl]pyrimidin-2-yl]amino]-1-iodopropan-2-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 66880052 |
| Molecular Formula | C25H25FIN7O4 |
| Molecular Weight | 633.42 g/mol |
| Exact Mass | 633.10 |
| IUPAC Name | N-[1-[[4-[4-(6-amino-5-methoxy-3-pyridinyl)-2-(4-fluorophenyl)-1,3-oxazol-5-yl]pyrimidin-2-yl]amino]-1-iodopropan-2-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)NC(C)C(I)Nc1nccc(-c2oc(-c3ccc(F)cc3)nc2-c2cnc(N)c(OC)c2)n1 |
| InChI | InChI=1S/C25H25FIN7O4/c1-13(31-19(35)12-36-2)22(27)34-25-29-9-8-17(32-25)21-20(15-10-18(37-3)23(28)30-11-15)33-24(38-21)14-4-6-16(26)7-5-14/h4-11,13,22H,12H2,1-3H3,(H2,28,30)(H,31,35)(H,29,32,34) |
| InChIKey | DYKDEMPMHHUGLV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|