C19H23N3O3 — CID 66880480
[3-[[(3-aminobenzoyl)amino]methyl]phenyl]-tert-butylcarbamic acid (PubChem CID 66880480) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is [3-[[(3-aminobenzoyl)amino]methyl]phenyl]-tert-butylcarbamic acid.
| Compound Name | [3-[[(3-aminobenzoyl)amino]methyl]phenyl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 66880480 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | [3-[[(3-aminobenzoyl)amino]methyl]phenyl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)c1cccc(CNC(=O)c2cccc(N)c2)c1 |
| InChI | InChI=1S/C19H23N3O3/c1-19(2,3)22(18(24)25)16-9-4-6-13(10-16)12-21-17(23)14-7-5-8-15(20)11-14/h4-11H,12,20H2,1-3H3,(H,21,23)(H,24,25) |
| InChIKey | LHWVBZPGNBZPCI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|