C16H21NO6 — CID 66880547
4-[bis(2-ethoxy-2-oxoethyl)amino]-3-methylbenzoic acid (PubChem CID 66880547) has the molecular formula C16H21NO6 and a molecular weight of 323.35 g/mol. Its IUPAC name is 4-[bis(2-ethoxy-2-oxoethyl)amino]-3-methylbenzoic acid.
| Compound Name | 4-[bis(2-ethoxy-2-oxoethyl)amino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 66880547 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 4-[bis(2-ethoxy-2-oxoethyl)amino]-3-methylbenzoic acid |
| SMILES | CCOC(=O)CN(CC(=O)OCC)c1ccc(C(=O)O)cc1C |
| InChI | InChI=1S/C16H21NO6/c1-4-22-14(18)9-17(10-15(19)23-5-2)13-7-6-12(16(20)21)8-11(13)3/h6-8H,4-5,9-10H2,1-3H3,(H,20,21) |
| InChIKey | GWKGIRFTOOCNBW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |