C13H19NO4 — CID 66880681
1-[(1S,2S)-2,3-diethoxycyclopentyl]pyrrole-2,5-dione (PubChem CID 66880681) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 1-[(1S,2S)-2,3-diethoxycyclopentyl]pyrrole-2,5-dione.
| Compound Name | 1-[(1S,2S)-2,3-diethoxycyclopentyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 66880681 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 1-[(1S,2S)-2,3-diethoxycyclopentyl]pyrrole-2,5-dione |
| SMILES | CCOC1CC[C@H](N2C(=O)C=CC2=O)[C@@H]1OCC |
| InChI | InChI=1S/C13H19NO4/c1-3-17-10-6-5-9(13(10)18-4-2)14-11(15)7-8-12(14)16/h7-10,13H,3-6H2,1-2H3/t9-,10?,13-/m0/s1 |
| InChIKey | KETBMQWDYQZXTC-DZGIZQBRSA-N |
| XLogP | 0.88 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|