C29H38FN7O2 — CID 66880756
N-[2-(ethylamino)ethyl]-N-[2-[(5-fluoro-1,3-dihydroisoindol-2-yl)-methylamino]-2-oxoethyl]-2-[(2-methyl-7,8,9,10-tetrahydropyrido[1,2-b]indazol-3-yl)amino]acetamide (PubChem CID 66880756) has the molecular formula C29H38FN7O2 and a molecular weight of 535.67 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-N-[2-[(5-fluoro-1,3-dihydroisoindol-2-yl)-methylamino]-2-oxoethyl]-2-[(2-methyl-7,8,9,10-tetrahydropyrido[1,2-b]indazol-3-yl)amino]acetamide.
| Compound Name | N-[2-(ethylamino)ethyl]-N-[2-[(5-fluoro-1,3-dihydroisoindol-2-yl)-methylamino]-2-oxoethyl]-2-[(2-methyl-7,8,9,10-tetrahydropyrido[1,2-b]indazol-3-yl)amino]acetamide |
|---|---|
| PubChem CID | 66880756 |
| Molecular Formula | C29H38FN7O2 |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-N-[2-[(5-fluoro-1,3-dihydroisoindol-2-yl)-methylamino]-2-oxoethyl]-2-[(2-methyl-7,8,9,10-tetrahydropyrido[1,2-b]indazol-3-yl)amino]acetamide |
| SMILES | CCNCCN(CC(=O)N(C)N1Cc2ccc(F)cc2C1)C(=O)CNc1cc2nn3c(c2cc1C)CCCC3 |
| InChI | InChI=1S/C29H38FN7O2/c1-4-31-10-12-35(19-29(39)34(3)36-17-21-8-9-23(30)14-22(21)18-36)28(38)16-32-25-15-26-24(13-20(25)2)27-7-5-6-11-37(27)33-26/h8-9,13-15,31-32H,4-7,10-12,16-19H2,1-3H3 |
| InChIKey | OSCCRKNGPHNLIC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 85.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|