C14H14F4N2O4 — CID 66880905
[2-[1-(2-fluoro-4-pyridinyl)piperidin-4-yl]oxy-2-oxoethyl] 2,2,2-trifluoroacetate (PubChem CID 66880905) has the molecular formula C14H14F4N2O4 and a molecular weight of 350.27 g/mol. Its IUPAC name is [2-[1-(2-fluoro-4-pyridinyl)piperidin-4-yl]oxy-2-oxoethyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[1-(2-fluoro-4-pyridinyl)piperidin-4-yl]oxy-2-oxoethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 66880905 |
| Molecular Formula | C14H14F4N2O4 |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | [2-[1-(2-fluoro-4-pyridinyl)piperidin-4-yl]oxy-2-oxoethyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(COC(=O)C(F)(F)F)OC1CCN(c2ccnc(F)c2)CC1 |
| InChI | InChI=1S/C14H14F4N2O4/c15-11-7-9(1-4-19-11)20-5-2-10(3-6-20)24-12(21)8-23-13(22)14(16,17)18/h1,4,7,10H,2-3,5-6,8H2 |
| InChIKey | MBPGMGCRFQSFLP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|