About 2-(3-benzylsulfanyl-4-pyridinyl)-5-(trifluoromethyl)-1,3-benzoxazole
2-(3-benzylsulfanyl-4-pyridinyl)-5-(trifluoromethyl)-1,3-benzoxazole (PubChem CID 66880935) has the molecular formula C20H13F3N2OS
and a molecular weight of 386.40 g/mol. Its IUPAC name is 2-(3-benzylsulfanyl-4-pyridinyl)-5-(trifluoromethyl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-(3-benzylsulfanyl-4-pyridinyl)-5-(trifluoromethyl)-1,3-benzoxazole |
| PubChem CID | 66880935 |
| Molecular Formula | C20H13F3N2OS |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 2-(3-benzylsulfanyl-4-pyridinyl)-5-(trifluoromethyl)-1,3-benzoxazole |
| SMILES | FC(F)(F)c1ccc2oc(-c3ccncc3SCc3ccccc3)nc2c1 |
| InChI | InChI=1S/C20H13F3N2OS/c21-20(22,23)14-6-7-17-16(10-14)25-19(26-17)15-8-9-24-11-18(15)27-12-13-4-2-1-3-5-13/h1-11H,12H2 |
| InChIKey | DSRFVTVRUBAXKL-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-benzylsulfanyl-4-pyridinyl)-5-(trifluoromethyl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-benzylsulfanyl-4-pyridinyl)-5-(trifluoromethyl)-1,3-benzoxazole?
The IUPAC name of 2-(3-benzylsulfanyl-4-pyridinyl)-5-(trifluoromethyl)-1,3-benzoxazole (CID 66880935) is 2-(3-benzylsulfanyl-4-pyridinyl)-5-(trifluoromethyl)-1,3-benzoxazole.
What is the SMILES notation for 2-(3-benzylsulfanyl-4-pyridinyl)-5-(trifluoromethyl)-1,3-benzoxazole?
The canonical SMILES for 2-(3-benzylsulfanyl-4-pyridinyl)-5-(trifluoromethyl)-1,3-benzoxazole is FC(F)(F)c1ccc2oc(-c3ccncc3SCc3ccccc3)nc2c1.
What is the InChIKey of 2-(3-benzylsulfanyl-4-pyridinyl)-5-(trifluoromethyl)-1,3-benzoxazole?
The InChIKey is DSRFVTVRUBAXKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13F3N2OS/c21-20(22,23)14-6-7-17-16(10-14)25-19(26-17)15-8-9-24-11-18(15)27-12-13-4-2-1-3-5-13/h1-11H,12H2.
What are the key properties of 2-(3-benzylsulfanyl-4-pyridinyl)-5-(trifluoromethyl)-1,3-benzoxazole?
2-(3-benzylsulfanyl-4-pyridinyl)-5-(trifluoromethyl)-1,3-benzoxazole has a molecular weight of 386.40 g/mol, XLogP of 6.20, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-benzylsulfanyl-4-pyridinyl)-5-(trifluoromethyl)-1,3-benzoxazole is sourced from PubChem (CID 66880935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).