About acetic acid;[1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate
acetic acid;[1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate (PubChem CID 66881113) has the molecular formula C16H16ClF3N2O4
and a molecular weight of 392.76 g/mol. Its IUPAC name is acetic acid;[1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | acetic acid;[1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate |
| PubChem CID | 66881113 |
| Molecular Formula | C16H16ClF3N2O4 |
| Molecular Weight | 392.76 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | acetic acid;[1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate |
| SMILES | CC(=O)O.N#Cc1c(Cl)cccc1N1CCC(OC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H12ClF3N2O2.C2H4O2/c15-11-2-1-3-12(10(11)8-19)20-6-4-9(5-7-20)22-13(21)14(16,17)18;1-2(3)4/h1-3,9H,4-7H2;1H3,(H,3,4) |
| InChIKey | YVXFQOKBWRLQKZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.76 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze acetic acid;[1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;[1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate?
The IUPAC name of acetic acid;[1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate (CID 66881113) is acetic acid;[1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate.
What is the SMILES notation for acetic acid;[1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate?
The canonical SMILES for acetic acid;[1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate is CC(=O)O.N#Cc1c(Cl)cccc1N1CCC(OC(=O)C(F)(F)F)CC1.
What is the InChIKey of acetic acid;[1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate?
The InChIKey is YVXFQOKBWRLQKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClF3N2O2.C2H4O2/c15-11-2-1-3-12(10(11)8-19)20-6-4-9(5-7-20)22-13(21)14(16,17)18;1-2(3)4/h1-3,9H,4-7H2;1H3,(H,3,4).
What are the key properties of acetic acid;[1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate?
acetic acid;[1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate has a molecular weight of 392.76 g/mol, XLogP of 3.38, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;[1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate is sourced from PubChem (CID 66881113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).