About [1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate
[1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate (PubChem CID 66881114) has the molecular formula C14H12ClF3N2O2
and a molecular weight of 332.71 g/mol. Its IUPAC name is [1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | [1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate |
| PubChem CID | 66881114 |
| Molecular Formula | C14H12ClF3N2O2 |
| Molecular Weight | 332.71 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | [1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate |
| SMILES | N#Cc1c(Cl)cccc1N1CCC(OC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H12ClF3N2O2/c15-11-2-1-3-12(10(11)8-19)20-6-4-9(5-7-20)22-13(21)14(16,17)18/h1-3,9H,4-7H2 |
| InChIKey | AVKCTCNTJWCNKU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.71 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate?
The IUPAC name of [1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate (CID 66881114) is [1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate.
What is the SMILES notation for [1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate?
The canonical SMILES for [1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate is N#Cc1c(Cl)cccc1N1CCC(OC(=O)C(F)(F)F)CC1.
What is the InChIKey of [1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate?
The InChIKey is AVKCTCNTJWCNKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClF3N2O2/c15-11-2-1-3-12(10(11)8-19)20-6-4-9(5-7-20)22-13(21)14(16,17)18/h1-3,9H,4-7H2.
What are the key properties of [1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate?
[1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate has a molecular weight of 332.71 g/mol, XLogP of 3.29, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3-chloro-2-cyanophenyl)piperidin-4-yl] 2,2,2-trifluoroacetate is sourced from PubChem (CID 66881114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).