C9H14N2O3 — CID 66881197
2-(2,5-dimethyl-3-oxo-1H-pyrazol-4-yl)butanoic acid (PubChem CID 66881197) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-(2,5-dimethyl-3-oxo-1H-pyrazol-4-yl)butanoic acid.
| Compound Name | 2-(2,5-dimethyl-3-oxo-1H-pyrazol-4-yl)butanoic acid |
|---|---|
| PubChem CID | 66881197 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 2-(2,5-dimethyl-3-oxo-1H-pyrazol-4-yl)butanoic acid |
| SMILES | CCC(C(=O)O)c1c(C)[nH]n(C)c1=O |
| InChI | InChI=1S/C9H14N2O3/c1-4-6(9(13)14)7-5(2)10-11(3)8(7)12/h6,10H,4H2,1-3H3,(H,13,14) |
| InChIKey | UBZSEDSLZNHUDN-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |