C21H35NO2 — CID 66881331
1-[(1S,2S,3S,4S)-2,3,4-tris(2-methylpropyl)cyclopentyl]pyrrole-2,5-dione (PubChem CID 66881331) has the molecular formula C21H35NO2 and a molecular weight of 333.52 g/mol. Its IUPAC name is 1-[(1S,2S,3S,4S)-2,3,4-tris(2-methylpropyl)cyclopentyl]pyrrole-2,5-dione.
| Compound Name | 1-[(1S,2S,3S,4S)-2,3,4-tris(2-methylpropyl)cyclopentyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 66881331 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | 1-[(1S,2S,3S,4S)-2,3,4-tris(2-methylpropyl)cyclopentyl]pyrrole-2,5-dione |
| SMILES | CC(C)C[C@H]1C[C@H](N2C(=O)C=CC2=O)[C@@H](CC(C)C)[C@H]1CC(C)C |
| InChI | InChI=1S/C21H35NO2/c1-13(2)9-16-12-19(22-20(23)7-8-21(22)24)18(11-15(5)6)17(16)10-14(3)4/h7-8,13-19H,9-12H2,1-6H3/t16-,17-,18-,19-/m0/s1 |
| InChIKey | CGMYXEHLJIXRNS-VJANTYMQSA-N |
| XLogP | 4.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|