C27H41N7O3 — CID 66881782
N-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[2-[N-[2-(ethylamino)ethyl]-2-methyl-5-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]-2-oxoethyl]amino]-N-methylacetamide (PubChem CID 66881782) has the molecular formula C27H41N7O3 and a molecular weight of 511.67 g/mol. Its IUPAC name is N-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[2-[N-[2-(ethylamino)ethyl]-2-methyl-5-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]-2-oxoethyl]amino]-N-methylacetamide.
| Compound Name | N-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[2-[N-[2-(ethylamino)ethyl]-2-methyl-5-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]-2-oxoethyl]amino]-N-methylacetamide |
|---|---|
| PubChem CID | 66881782 |
| Molecular Formula | C27H41N7O3 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.33 |
| IUPAC Name | N-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[2-[N-[2-(ethylamino)ethyl]-2-methyl-5-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]-2-oxoethyl]amino]-N-methylacetamide |
| SMILES | CCNCCN(C(=O)CNCC(=O)N(C)N1C[C@H]2CCCC[C@H]2C1)c1cc(-c2noc(C)n2)ccc1C |
| InChI | InChI=1S/C27H41N7O3/c1-5-28-12-13-34(24-14-21(11-10-19(24)2)27-30-20(3)37-31-27)26(36)16-29-15-25(35)32(4)33-17-22-8-6-7-9-23(22)18-33/h10-11,14,22-23,28-29H,5-9,12-13,15-18H2,1-4H3/t22-,23+ |
| InChIKey | LYKZSJFZVDQXEK-ZRZAMGCNSA-N |
| XLogP | 2.38 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|