About 7-chloro-2-methyl-8-(2,2,2-trichloroethyl)quinoxaline
7-chloro-2-methyl-8-(2,2,2-trichloroethyl)quinoxaline (PubChem CID 66882040) has the molecular formula C11H8Cl4N2
and a molecular weight of 310.01 g/mol. Its IUPAC name is 7-chloro-2-methyl-8-(2,2,2-trichloroethyl)quinoxaline.
Molecular Properties
| Compound Name | 7-chloro-2-methyl-8-(2,2,2-trichloroethyl)quinoxaline |
| PubChem CID | 66882040 |
| Molecular Formula | C11H8Cl4N2 |
| Molecular Weight | 310.01 g/mol |
| Exact Mass | 307.94 |
| IUPAC Name | 7-chloro-2-methyl-8-(2,2,2-trichloroethyl)quinoxaline |
| SMILES | Cc1cnc2ccc(Cl)c(CC(Cl)(Cl)Cl)c2n1 |
| InChI | InChI=1S/C11H8Cl4N2/c1-6-5-16-9-3-2-8(12)7(10(9)17-6)4-11(13,14)15/h2-3,5H,4H2,1H3 |
| InChIKey | IIQRHQLXUOPLHR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.01 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-2-methyl-8-(2,2,2-trichloroethyl)quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2-methyl-8-(2,2,2-trichloroethyl)quinoxaline?
The IUPAC name of 7-chloro-2-methyl-8-(2,2,2-trichloroethyl)quinoxaline (CID 66882040) is 7-chloro-2-methyl-8-(2,2,2-trichloroethyl)quinoxaline.
What is the SMILES notation for 7-chloro-2-methyl-8-(2,2,2-trichloroethyl)quinoxaline?
The canonical SMILES for 7-chloro-2-methyl-8-(2,2,2-trichloroethyl)quinoxaline is Cc1cnc2ccc(Cl)c(CC(Cl)(Cl)Cl)c2n1.
What is the InChIKey of 7-chloro-2-methyl-8-(2,2,2-trichloroethyl)quinoxaline?
The InChIKey is IIQRHQLXUOPLHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8Cl4N2/c1-6-5-16-9-3-2-8(12)7(10(9)17-6)4-11(13,14)15/h2-3,5H,4H2,1H3.
What are the key properties of 7-chloro-2-methyl-8-(2,2,2-trichloroethyl)quinoxaline?
7-chloro-2-methyl-8-(2,2,2-trichloroethyl)quinoxaline has a molecular weight of 310.01 g/mol, XLogP of 4.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2-methyl-8-(2,2,2-trichloroethyl)quinoxaline is sourced from PubChem (CID 66882040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).