About 1-(1H-pyrazol-5-yl)-3,4-dihydro-2H-pyridine
1-(1H-pyrazol-5-yl)-3,4-dihydro-2H-pyridine (PubChem CID 66882589) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 1-(1H-pyrazol-5-yl)-3,4-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-(1H-pyrazol-5-yl)-3,4-dihydro-2H-pyridine |
| PubChem CID | 66882589 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 1-(1H-pyrazol-5-yl)-3,4-dihydro-2H-pyridine |
| SMILES | C1=CN(c2ccn[nH]2)CCC1 |
| InChI | InChI=1S/C8H11N3/c1-2-6-11(7-3-1)8-4-5-9-10-8/h2,4-6H,1,3,7H2,(H,9,10) |
| InChIKey | JTMREYIZVRSBKK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1H-pyrazol-5-yl)-3,4-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-pyrazol-5-yl)-3,4-dihydro-2H-pyridine?
The IUPAC name of 1-(1H-pyrazol-5-yl)-3,4-dihydro-2H-pyridine (CID 66882589) is 1-(1H-pyrazol-5-yl)-3,4-dihydro-2H-pyridine.
What is the SMILES notation for 1-(1H-pyrazol-5-yl)-3,4-dihydro-2H-pyridine?
The canonical SMILES for 1-(1H-pyrazol-5-yl)-3,4-dihydro-2H-pyridine is C1=CN(c2ccn[nH]2)CCC1.
What is the InChIKey of 1-(1H-pyrazol-5-yl)-3,4-dihydro-2H-pyridine?
The InChIKey is JTMREYIZVRSBKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c1-2-6-11(7-3-1)8-4-5-9-10-8/h2,4-6H,1,3,7H2,(H,9,10).
What are the key properties of 1-(1H-pyrazol-5-yl)-3,4-dihydro-2H-pyridine?
1-(1H-pyrazol-5-yl)-3,4-dihydro-2H-pyridine has a molecular weight of 149.20 g/mol, XLogP of 1.52, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-pyrazol-5-yl)-3,4-dihydro-2H-pyridine is sourced from PubChem (CID 66882589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).