C11H15NO2 — CID 66882607
1-[(1S,2S,3S)-2,3-dimethylcyclopentyl]pyrrole-2,5-dione (PubChem CID 66882607) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 1-[(1S,2S,3S)-2,3-dimethylcyclopentyl]pyrrole-2,5-dione.
| Compound Name | 1-[(1S,2S,3S)-2,3-dimethylcyclopentyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 66882607 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 1-[(1S,2S,3S)-2,3-dimethylcyclopentyl]pyrrole-2,5-dione |
| SMILES | C[C@H]1[C@@H](C)CC[C@@H]1N1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H15NO2/c1-7-3-4-9(8(7)2)12-10(13)5-6-11(12)14/h5-9H,3-4H2,1-2H3/t7-,8-,9-/m0/s1 |
| InChIKey | AIWKSXNKWWKNEH-CIUDSAMLSA-N |
| XLogP | 1.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|